cas: 20358-06-9 — see every product listed under this CAS number, including other names
2-Amino-4-fluorobenzothiazole, 97%, 97% (CAS 20358-06-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11301F-1g |
| cas | 20358-06-9 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 309.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-1,3-benzothiazol-2-amine (CAS 20358-06-9) is a chemical compound with the molecular formula C7H5FN2S and a molecular weight of 168.19 g/mol. IUPAC name: 4-fluoro-1,3-benzothiazol-2-amine. InChIKey: CBVRCEFUXXJLSG-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2S |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | CBVRCEFUXXJLSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)F |
Computed by PubChem (NCBI)