cas: 20358-06-9 — see every product listed under this CAS number, including other names
4-Fluorobenzo[d]thiazol-2-amine, 98% (CAS 20358-06-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223071-5G |
| cas | 20358-06-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 596.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-1,3-benzothiazol-2-amine (CAS 20358-06-9) is a chemical compound with the molecular formula C7H5FN2S and a molecular weight of 168.19 g/mol. IUPAC name: 4-fluoro-1,3-benzothiazol-2-amine. InChIKey: CBVRCEFUXXJLSG-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2S |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | CBVRCEFUXXJLSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)F |
Computed by PubChem (NCBI)