cas: 1008-35-1 — see every product listed under this CAS number, including other names
2-Amino-5,6,7,8-tetrahydropteridin-4(3H)-one, 95%, 95% (CAS 1008-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110QY3-100mg |
| cas | 1008-35-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one (CAS 1008-35-1) is a chemical compound with the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. IUPAC name: 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one. InChIKey: BOEUHAUGJSOEDZ-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| InChIKey | BOEUHAUGJSOEDZ-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)