CAS 1008-35-1 appears in our catalog under these names: Tetrahydrobiopterin Impurity 1, Sapropterin Impurity 20, Biopterin Impurity 3, tetrahydropterin, 2-Amino-5,6,7,8-tetrahydropteridin-4(3H)-one, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, GLPBio, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg.
2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one (CAS 1008-35-1) is a chemical compound with the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. IUPAC name: 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one. InChIKey: BOEUHAUGJSOEDZ-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 2-amino-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| InChIKey | BOEUHAUGJSOEDZ-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)