2-Amino-5-bromo-N-phenylbenzamide, 95%
cas: 82827-16-5 — see every product listed under this CAS number, including other names
2-Amino-5-bromo-N-phenylbenzamide, 95% (CAS 82827-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1593043-100mg |
| cas | 82827-16-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 820.94 Pln | |
| Ambeed | 250mg | 1360.50 Pln | |
| Ambeed | 1g | 3691.19 Pln | |
| BLDpharm | 100mg | 808.63 Pln | |
| BLDpharm | 250mg | 1336.22 Pln | |
| BLDpharm | 1g | 3618.75 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1206.80 Pln | |
| Chemat | 1g | 3146.00 Pln | |
| Fluorochem | 100mg | 1367.24 Pln | |
| Fluorochem | 250mg | 2236.73 Pln | |
| Fluorochem | 1g | 5834.42 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-5-bromo-N-phenylbenzamide (CAS 82827-16-5) is a chemical compound with the molecular formula C13H11BrN2O and a molecular weight of 291.14 g/mol. IUPAC name: 2-amino-5-bromo-N-phenylbenzamide. InChIKey: QFELSXHMYYOYPG-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 2-amino-5-bromo-N-phenylbenzamide |
| InChIKey | QFELSXHMYYOYPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C=CC(=C2)Br)N |
Computed by PubChem (NCBI)