cas: 54734-84-8 — see every product listed under this CAS number, including other names
2-Amino-5-bromobenzenesulfonamide hydrobromide, 90% (CAS 54734-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046236-1G |
| cas | 54734-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Fluorochem | 10g | 1221.46 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
2-amino-5-bromobenzenesulfonamide (CAS 54734-84-8) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 2-amino-5-bromobenzenesulfonamide. InChIKey: BGILQOXCWMHWOM-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 2-amino-5-bromobenzenesulfonamide |
| InChIKey | BGILQOXCWMHWOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)N)N |
Computed by PubChem (NCBI)