CAS 1215943-03-5 appears in our catalog under these names: 6-Bromo-n-methylpyridine-3-sulfonamide, 95%, 6-Bromo-N-methylpyridine-3-sulfonamide, 95+%, 6-Bromo-N-methylpyridine-3-sulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-bromo-N-methylpyridine-3-sulfonamide (CAS 1215943-03-5) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 6-bromo-N-methylpyridine-3-sulfonamide. InChIKey: MDUQILGKKMSQET-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 6-bromo-N-methylpyridine-3-sulfonamide |
| InChIKey | MDUQILGKKMSQET-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)