cas: 45867-11-6 — see every product listed under this CAS number, including other names
2-Amino-5-chloropyrimidine-4-carboxylic acid, 95%, 95% (CAS 45867-11-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DC18-10g |
| cas | 45867-11-6 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 8085.20 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1398.80 Pln | |
| Chemat | 5g | 4072.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-chloropyrimidine-4-carboxylic acid (CAS 45867-11-6) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 2-amino-5-chloropyrimidine-4-carboxylic acid. InChIKey: PDLZOTZLGNZOFS-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 2-amino-5-chloropyrimidine-4-carboxylic acid |
| InChIKey | PDLZOTZLGNZOFS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)N)C(=O)O)Cl |
Computed by PubChem (NCBI)