Products 1322627-52-0
CAS 1322627-52-0 appears in our catalog under these names: (2Z)-3-(5-Chloro-1h-1,2,4-triazol-3-yl)acrylic acid, 95%, 3-(5-Chloro-1H-1,2,4-triazol-3-yl)acrylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoic acid (CAS 1322627-52-0) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: (Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoic acid. InChIKey: GZNAFTZWFWSTFJ-UPHRSURJSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | (Z)-3-(5-chloro-1H-1,2,4-triazol-3-yl)prop-2-enoic acid |
| InChIKey | GZNAFTZWFWSTFJ-UPHRSURJSA-N |
| SMILES | C(=C\C(=O)O)\C1=NNC(=N1)Cl |
Computed by PubChem (NCBI)