cas: 95211-68-0 — see every product listed under this CAS number, including other names
2-Amino-6-methyl-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid amide, 96% (CAS 95211-68-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F057803-5G |
| cas | 95211-68-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 695.61 Pln | |
| Fluorochem | 10g | 1257.91 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (CAS 95211-68-0) is a chemical compound with the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. IUPAC name: 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide. InChIKey: LSRQCZCDBRHPHQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2OS |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| InChIKey | LSRQCZCDBRHPHQ-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC(=C2C(=O)N)N |
Computed by PubChem (NCBI)