CAS 777880-70-3 is the registry number for 5-Methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (CAS 777880-70-3) is a chemical compound with the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. IUPAC name: 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide. InChIKey: OXNMMXRMVHHCBQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2OS |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| InChIKey | OXNMMXRMVHHCBQ-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C=C(S2)C(=O)NN |
Computed by PubChem (NCBI)