cas: 37409-97-5 — see every product listed under this CAS number, including other names
2-Amino-6-morpholin-4-yl-3 H -pyrimidin-4-one, 97% (CAS 37409-97-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030045-1G |
| cas | 37409-97-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2200.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-4-morpholin-4-yl-1H-pyrimidin-6-one (CAS 37409-97-5) is a chemical compound with the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. IUPAC name: 2-amino-4-morpholin-4-yl-1H-pyrimidin-6-one. InChIKey: HRJPJKYVYIRMPZ-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O2 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 2-amino-4-morpholin-4-yl-1H-pyrimidin-6-one |
| InChIKey | HRJPJKYVYIRMPZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=O)NC(=N2)N |
Computed by PubChem (NCBI)