Products 89239-25-8
CAS 89239-25-8 is the registry number for 4-Acetamido-1,3-dimethyl-1h-pyrazole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-acetamido-1,3-dimethylpyrazole-5-carboxamide (CAS 89239-25-8) is a chemical compound with the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. IUPAC name: 4-acetamido-1,3-dimethylpyrazole-5-carboxamide. InChIKey: DQZMTADDBWFDNL-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O2 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 4-acetamido-1,3-dimethylpyrazole-5-carboxamide |
| InChIKey | DQZMTADDBWFDNL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1NC(=O)C)C(=O)N)C |
Computed by PubChem (NCBI)