cas: 98-44-2 — see every product listed under this CAS number, including other names
2-Aminobenzene-1,4-disulfonic acid, 95%, 95% (CAS 98-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NWI-1g |
| cas | 98-44-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 626.00 Pln | |
| Chemat | 100g | 1557.20 Pln | |
| Chemat | 500g | 4617.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-aminobenzene-1,4-disulfonic acid (CAS 98-44-2) is a chemical compound with the molecular formula C6H7NO6S2 and a molecular weight of 253.3 g/mol. IUPAC name: 2-aminobenzene-1,4-disulfonic acid. InChIKey: LDCCBULMAFILCT-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 2-aminobenzene-1,4-disulfonic acid |
| InChIKey | LDCCBULMAFILCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)