CAS 5294-05-3 appears in our catalog under these names: 5-Amino-1,3-benzenedisulfonic acid, 95%, 5-Aminobenzene-1,3-disulfonic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 25g, 5g, 1g.
5-aminobenzene-1,3-disulfonic acid (CAS 5294-05-3) is a chemical compound with the molecular formula C6H7NO6S2 and a molecular weight of 253.3 g/mol. IUPAC name: 5-aminobenzene-1,3-disulfonic acid. InChIKey: GBWNQBBVSVGAAL-UHFFFAOYSA-N.
| Molecular formula | C6H7NO6S2 |
|---|---|
| Molecular weight | 253.3 g/mol |
| IUPAC name | 5-aminobenzene-1,3-disulfonic acid |
| InChIKey | GBWNQBBVSVGAAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)