2-Aminobenzophenone, 99%, 99%
cas: 2835-77-0 — see every product listed under this CAS number, including other names
2-Aminobenzophenone, 99%, 99% (CAS 2835-77-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114453-5g |
| cas | 2835-77-0 |
| size | 5g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 250g | 203.60 Pln | |
| Chemat | 500g | 408.00 Pln | |
| Chemat | 1kg | 712.40 Pln | |
| Chemat | 25kg | price on request |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2-aminophenyl)-phenylmethanone (CAS 2835-77-0) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (2-aminophenyl)-phenylmethanone. InChIKey: MAOBFOXLCJIFLV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (2-aminophenyl)-phenylmethanone |
| InChIKey | MAOBFOXLCJIFLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)