CAS 649765-17-3 appears in our catalog under these names: Cis-2-amino-cyclooctanecarboxylic acid, 95%, 2-Aminocyclooctane-COOH (S,R/R,S). Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 100mg, 5g, 250mg, 1g.
Cis-(1R,2S)-2-aminocyclooctane-1-carboxylic acid (CAS 649765-17-3) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclooctane-1-carboxylic acid. InChIKey: RNDBJXMOBPVFAS-SFYZADRCSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclooctane-1-carboxylic acid |
| InChIKey | RNDBJXMOBPVFAS-SFYZADRCSA-N |
| SMILES | C1CCC[C@@H]([C@@H](CC1)C(=O)O)N |
Computed by PubChem (NCBI)