cas: 736919-39-4 — see every product listed under this CAS number, including other names
2-Aminoquinoline-6-carboxylic acid, 95%, 95% (CAS 736919-39-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116LT5-50mg |
| cas | 736919-39-4 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 1139.60 Pln | |
| Chemat | 1g | 2762.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-aminoquinoline-6-carboxylic acid (CAS 736919-39-4) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-aminoquinoline-6-carboxylic acid. InChIKey: RGFNYRASTCKUCA-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-aminoquinoline-6-carboxylic acid |
| InChIKey | RGFNYRASTCKUCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1C(=O)O |
Computed by PubChem (NCBI)