cas: 2173992-27-1 — see every product listed under this CAS number, including other names
2-Azaspiro[3.3]heptane-6-acetic acid, 2-[(1,1-dimethylethoxy)carbonyl]-, ethyl ester, 95%, 95% (CAS 2173992-27-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FN8W-100mg |
| cas | 2173992-27-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 1g | 3078.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-(2-ethoxy-2-oxoethyl)-2-azaspiro[3.3]heptane-2-carboxylate (CAS 2173992-27-1) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: tert-butyl 6-(2-ethoxy-2-oxoethyl)-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: CFKBRQLBFVSEBV-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | tert-butyl 6-(2-ethoxy-2-oxoethyl)-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | CFKBRQLBFVSEBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CC2(C1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)