CAS 1242268-17-2 appears in our catalog under these names: 6-tert-Butyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate, 95%, 6-tert-Butyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate 95%, 6-TERT-BUTYL 1-ETHYL 6-AZASPIRO[2.5]OCTANE-1,6-DICARBOXYLATE, 95%, 95%, 6-TERT-BUTYL 1-ETHYL 6-AZASPIRO[2.5]OCTANE-1,6-DICARBOXYLATE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate (CAS 1242268-17-2) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate. InChIKey: MWXOEHQQUHBXTN-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-ethyl 6-azaspiro[2.5]octane-2,6-dicarboxylate |
| InChIKey | MWXOEHQQUHBXTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC12CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)