cas: 45990-12-3 — see every product listed under this CAS number, including other names
2-Azatricyclo[6.3.1.0,4,12]dodeca-1(12),4,6,8,10-pentaene 95% (CAS 45990-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1129152-100mg |
| cas | 45990-12-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1822.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1129152 |
1,2-dihydrobenzo[cd]indole (CAS 45990-12-3) is a chemical compound with the molecular formula C11H9N and a molecular weight of 155.20 g/mol. IUPAC name: 1,2-dihydrobenzo[cd]indole. InChIKey: HFJHUOIVZVHBBM-UHFFFAOYSA-N.
| Molecular formula | C11H9N |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | 1,2-dihydrobenzo[cd]indole |
| InChIKey | HFJHUOIVZVHBBM-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=C2C(=CC=C3)N1 |
Computed by PubChem (NCBI)