CAS 45990-12-3 appears in our catalog under these names: 1,2-dihydrobenzo[cd]indole, 95%, 2–Azatricyclo(6·3·1·0,4,12)dodeca–1(12),4,6,8,10–pentaene, 2-Azatricyclo[6.3.1.0,4,12]dodeca-1(12),4,6,8,10-pentaene 95%, 2-Azatricyclo[6.3.1.0,4,12]dodeca-1(12),4,6,8,10-pentaene, 95%, 95%, 2-Azatricyclo[6.3.1.0,4,12]dodeca-1(12),4,6,8,10-pentaene, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
1,2-dihydrobenzo[cd]indole (CAS 45990-12-3) is a chemical compound with the molecular formula C11H9N and a molecular weight of 155.20 g/mol. IUPAC name: 1,2-dihydrobenzo[cd]indole. InChIKey: HFJHUOIVZVHBBM-UHFFFAOYSA-N.
| Molecular formula | C11H9N |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | 1,2-dihydrobenzo[cd]indole |
| InChIKey | HFJHUOIVZVHBBM-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=C2C(=CC=C3)N1 |
Computed by PubChem (NCBI)