cas: 1365639-14-0 — see every product listed under this CAS number, including other names
2-BENZYL-6-OXO-2-AZA-SPIRO[3.3]HEPTANE, 97% (CAS 1365639-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502750-100MG |
| cas | 1365639-14-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2486.64 Pln | |
| Fluorochem | 250mg | 3939.26 Pln | |
| Fluorochem | 500mg | 6511.27 Pln | |
| Fluorochem | 1g | 9718.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-benzyl-2-azaspiro[3.3]heptan-6-one (CAS 1365639-14-0) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 2-benzyl-2-azaspiro[3.3]heptan-6-one. InChIKey: SLRJFVDHYZWHES-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 2-benzyl-2-azaspiro[3.3]heptan-6-one |
| InChIKey | SLRJFVDHYZWHES-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC12CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)