cas: 63842-87-5 — see every product listed under this CAS number, including other names
2-BUTOXYSUCCINIC ACID, DIBUTYLESTER, 95% (CAS 63842-87-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F813042-100MG |
| cas | 63842-87-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1362.04 Pln | |
| Fluorochem | 1g | 3517.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dibutyl 2-butoxybutanedioate (CAS 63842-87-5) is a chemical compound with the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. IUPAC name: dibutyl 2-butoxybutanedioate. InChIKey: GGAWXQQNQGESAW-UHFFFAOYSA-N.
| Molecular formula | C16H30O5 |
|---|---|
| Molecular weight | 302.41 g/mol |
| IUPAC name | dibutyl 2-butoxybutanedioate |
| InChIKey | GGAWXQQNQGESAW-UHFFFAOYSA-N |
| SMILES | CCCCOC(CC(=O)OCCCC)C(=O)OCCCC |
Computed by PubChem (NCBI)