Products 740747-76-6

CAS 740747-76-6 is the registry number for Hydroxy((2-(((2-(2-methoxyethoxy)propyl)amino)carbonyl)phenoxy)acetato(2-))mercurate(1-) Coordination Compound. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-ethyl-5-(oxan-2-ylperoxy)hexanoate (CAS 740747-76-6) is a chemical compound with the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. IUPAC name: propan-2-yl 2-ethyl-5-(oxan-2-ylperoxy)hexanoate. InChIKey: RQCSSJQHJAFCIP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30O5
Molecular weight302.41 g/mol
IUPAC namepropan-2-yl 2-ethyl-5-(oxan-2-ylperoxy)hexanoate
InChIKeyRQCSSJQHJAFCIP-UHFFFAOYSA-N
SMILESCCC(CCC(C)OOC1CCCCO1)C(=O)OC(C)C

Computed by PubChem (NCBI)