cas: 84102-75-0 — see every product listed under this CAS number, including other names
2-Benzofurancarboxylic acid, 5-cyano-, ≥95%, ≥95% (CAS 84102-75-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115SSV-1g |
| cas | 84102-75-0 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4466.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-cyano-1-benzofuran-2-carboxylic acid (CAS 84102-75-0) is a chemical compound with the molecular formula C10H5NO3 and a molecular weight of 187.15 g/mol. IUPAC name: 5-cyano-1-benzofuran-2-carboxylic acid. InChIKey: UJQXZANNFIHPGV-UHFFFAOYSA-N.
| Molecular formula | C10H5NO3 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 5-cyano-1-benzofuran-2-carboxylic acid |
| InChIKey | UJQXZANNFIHPGV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)