CAS 84102-75-0 appears in our catalog under these names: 5-Cyanobenzofuran-2-carboxylic acid, 95%, 5-Cyanobenzofuran-2-carboxylic acid, 98+%, 2-Benzofurancarboxylic acid, 5-cyano-, ≥95%, ≥95%, 5-Cyanobenzofuran-2-carboxylic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
5-cyano-1-benzofuran-2-carboxylic acid (CAS 84102-75-0) is a chemical compound with the molecular formula C10H5NO3 and a molecular weight of 187.15 g/mol. IUPAC name: 5-cyano-1-benzofuran-2-carboxylic acid. InChIKey: UJQXZANNFIHPGV-UHFFFAOYSA-N.
| Molecular formula | C10H5NO3 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 5-cyano-1-benzofuran-2-carboxylic acid |
| InChIKey | UJQXZANNFIHPGV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)