cas: 867009-61-8 — see every product listed under this CAS number, including other names
2-Benzyl-2,8-diazaspiro[4.5]decane, 95% (CAS 867009-61-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217100-50MG |
| cas | 867009-61-8 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 586.27 Pln | |
| Fluorochem | 100mg | 669.57 Pln | |
| Fluorochem | 250mg | 1106.92 Pln | |
| Fluorochem | 500mg | 1726.49 Pln | |
| Fluorochem | 1g | 2137.81 Pln | |
| Fluorochem | 2.5g | 4387.01 Pln | |
| Fluorochem | 5g | 6245.74 Pln | |
| Fluorochem | 10g | 10171.44 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-benzyl-2,8-diazaspiro[4.5]decane (CAS 867009-61-8) is a chemical compound with the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. IUPAC name: 2-benzyl-2,8-diazaspiro[4.5]decane. InChIKey: XTNWFMYRGJBRAD-UHFFFAOYSA-N.
| Molecular formula | C15H22N2 |
|---|---|
| Molecular weight | 230.35 g/mol |
| IUPAC name | 2-benzyl-2,8-diazaspiro[4.5]decane |
| InChIKey | XTNWFMYRGJBRAD-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CCN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)