CAS 86580-67-8 is the registry number for exo-9-Benzyl-9-azabicyclo[3.3.1]nonan-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine (CAS 86580-67-8) is a chemical compound with the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. IUPAC name: (1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine. InChIKey: UWEVJKJUENNRQT-GOOCMWNKSA-N.
| Molecular formula | C15H22N2 |
|---|---|
| Molecular weight | 230.35 g/mol |
| IUPAC name | (1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine |
| InChIKey | UWEVJKJUENNRQT-GOOCMWNKSA-N |
| SMILES | C1C[C@@H]2CC(C[C@H](C1)N2CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)