cas: 185692-51-7 — see every product listed under this CAS number, including other names
2-Benzylhexahydrocyclopenta[c]pyrrol-4(2H)-one 97% (CAS 185692-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A522054-100mg |
| cas | 185692-51-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1093.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A522054 |
2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one (CAS 185692-51-7) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one. InChIKey: DLTLETIGPVMJIX-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one |
| InChIKey | DLTLETIGPVMJIX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2C1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)