cas: 185692-51-7 — see every product listed under this CAS number, including other names
2-Benzylhexahydrocyclopenta[c]pyrrol-4(2H)-one, 97%, 97% (CAS 185692-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AP65-100mg |
| cas | 185692-51-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 3030.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one (CAS 185692-51-7) is a chemical compound with the molecular formula C14H17NO and a molecular weight of 215.29 g/mol. IUPAC name: 2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one. InChIKey: DLTLETIGPVMJIX-UHFFFAOYSA-N.
| Molecular formula | C14H17NO |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | 2-benzyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-one |
| InChIKey | DLTLETIGPVMJIX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2C1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)