cas: 954240-14-3 — see every product listed under this CAS number, including other names
2-Boc-2,8-Diazaspiro[5.5]undecane, 98% (CAS 954240-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236672-100MG |
| cas | 954240-14-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 500mg | 945.52 Pln | |
| Fluorochem | 1g | 1362.04 Pln | |
| Fluorochem | 5g | 4439.08 Pln | |
| Fluorochem | 10g | 8812.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2,8-diazaspiro[5.5]undecane-2-carboxylate (CAS 954240-14-3) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[5.5]undecane-2-carboxylate. InChIKey: ZDKVVQZKWMSQDY-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[5.5]undecane-2-carboxylate |
| InChIKey | ZDKVVQZKWMSQDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCCNC2 |
Computed by PubChem (NCBI)