CAS 101654-34-6 appears in our catalog under these names: 2-Bromo-1,3,4-trichlorobenzene, 95%, 2-Bromo-1,3,4-trichlorobenzene, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 1g.
2-bromo-1,3,4-trichlorobenzene (CAS 101654-34-6) is a chemical compound with the molecular formula C6H2BrCl3 and a molecular weight of 260.3 g/mol. IUPAC name: 2-bromo-1,3,4-trichlorobenzene. InChIKey: PMKFTVRACGMWCQ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 2-bromo-1,3,4-trichlorobenzene |
| InChIKey | PMKFTVRACGMWCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)Br)Cl |
Computed by PubChem (NCBI)