CAS 29682-44-8 appears in our catalog under these names: 1-Bromo-2,4,5-trichlorobenzene, 1–BROMO–2,4,5–TRICHLOROBENZENE, 1-Bromo-2,4,5-trichlorobenzene 97%, 1-Bromo-2,4,5-trichlorobenzene, 97%, 97%, 1-Bromo-2,4,5-trichlorobenzene, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 500mg, 5g, 100g, 500g, 1g, 10g.
1-bromo-2,4,5-trichlorobenzene (CAS 29682-44-8) is a chemical compound with the molecular formula C6H2BrCl3 and a molecular weight of 260.3 g/mol. IUPAC name: 1-bromo-2,4,5-trichlorobenzene. InChIKey: PHDKZIIWDGIUCG-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl3 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | 1-bromo-2,4,5-trichlorobenzene |
| InChIKey | PHDKZIIWDGIUCG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)Cl)Cl |
Computed by PubChem (NCBI)