2-Bromo-1-fluoronaphthalene, 95%
cas: 317-79-3 — see every product listed under this CAS number, including other names
2-Bromo-1-fluoronaphthalene, 95% (CAS 317-79-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-6753-1g |
| cas | 317-79-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| Ambeed | 10g | 3401.94 Pln | |
| Ambeed | 25g | 7735.13 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 1653.20 Pln | |
| Chemat | 10g | 2848.40 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 719.77 Pln | |
| BLDpharm | 5g | 2124.83 Pln | |
| BLDpharm | 10g | 3663.18 Pln | |
| BLDpharm | 25g | 8339.31 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1086.09 Pln | |
| Fluorochem | 5g | 3080.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-bromo-1-fluoronaphthalene (CAS 317-79-3) is a chemical compound with the molecular formula C10H6BrF and a molecular weight of 225.06 g/mol. IUPAC name: 2-bromo-1-fluoronaphthalene. InChIKey: WPNSUUQOEPQDOI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF |
|---|---|
| Molecular weight | 225.06 g/mol |
| IUPAC name | 2-bromo-1-fluoronaphthalene |
| InChIKey | WPNSUUQOEPQDOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2F)Br |
Computed by PubChem (NCBI)