2-Bromo-11H-benzo[b]fluoren-11-one, 98%
cas: 1923756-29-9 — see every product listed under this CAS number, including other names
2-Bromo-11H-benzo[b]fluoren-11-one, 98% (CAS 1923756-29-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F544941-1G |
| cas | 1923756-29-9 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 601.89 Pln | |
| Fluorochem | 10g | 945.52 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 10g | 626.25 Pln | |
| Ambeed | 25g | 1260.38 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 568.40 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 442.09 Pln | |
| BLDpharm | 10g | 669.79 Pln | |
| BLDpharm | 25g | 1352.88 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-bromobenzo[b]fluoren-11-one (CAS 1923756-29-9) is a chemical compound with the molecular formula C17H9BrO and a molecular weight of 309.16 g/mol. IUPAC name: 2-bromobenzo[b]fluoren-11-one. InChIKey: BLDJNELYMBXNGF-UHFFFAOYSA-N.
| Molecular formula | C17H9BrO |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | 2-bromobenzo[b]fluoren-11-one |
| InChIKey | BLDJNELYMBXNGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(C3=O)C=C(C=C4)Br |
Computed by PubChem (NCBI)