CAS 64356-33-8 is the registry number for 5–Bromo–7H–benzo(c)fluoren–7–one. Offered by: GLPBio. Available pack sizes: 250mg.
5-bromobenzo[c]fluoren-7-one (CAS 64356-33-8) is a chemical compound with the molecular formula C17H9BrO and a molecular weight of 309.16 g/mol. IUPAC name: 5-bromobenzo[c]fluoren-7-one. InChIKey: DSHOXYZGFKAFLO-UHFFFAOYSA-N.
| Molecular formula | C17H9BrO |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | 5-bromobenzo[c]fluoren-7-one |
| InChIKey | DSHOXYZGFKAFLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C2C4=CC=CC=C4C3=O)Br |
Computed by PubChem (NCBI)