cas: 204205-33-4 — see every product listed under this CAS number, including other names
2-Bromo-2-(2-fluorophenyl)-1-cyclopropylethanone 90% (CAS 204205-33-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A302471-5g |
| cas | 204205-33-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1744.31 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A302471 |
2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone (CAS 204205-33-4) is a chemical compound with the molecular formula C11H10BrFO and a molecular weight of 257.10 g/mol. IUPAC name: 2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone. InChIKey: LMCZCCDXOZGIND-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO |
|---|---|
| Molecular weight | 257.10 g/mol |
| IUPAC name | 2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone |
| InChIKey | LMCZCCDXOZGIND-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C(C2=CC=CC=C2F)Br |
Computed by PubChem (NCBI)