cas: 204205-33-4 — see every product listed under this CAS number, including other names
2-Bromo-2-(2-fluorophenyl)-1-cyclopropylethanone, 94%, 94% (CAS 204205-33-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130CD-1g |
| cas | 204205-33-4 |
| size | 1g |
| availability | 1800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1307.60 Pln |
| purity | 94% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone (CAS 204205-33-4) is a chemical compound with the molecular formula C11H10BrFO and a molecular weight of 257.10 g/mol. IUPAC name: 2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone. InChIKey: LMCZCCDXOZGIND-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO |
|---|---|
| Molecular weight | 257.10 g/mol |
| IUPAC name | 2-bromo-1-cyclopropyl-2-(2-fluorophenyl)ethanone |
| InChIKey | LMCZCCDXOZGIND-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C(C2=CC=CC=C2F)Br |
Computed by PubChem (NCBI)