cas: 124244-65-1 — see every product listed under this CAS number, including other names
2-Bromo-3,6-difluorobenzoic acid, 97% (CAS 124244-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043160-1G |
| cas | 124244-65-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1320.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-3,6-difluorobenzoic acid (CAS 124244-65-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 2-bromo-3,6-difluorobenzoic acid. InChIKey: ZLBFRHCWALNQIJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 2-bromo-3,6-difluorobenzoic acid |
| InChIKey | ZLBFRHCWALNQIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)Br)F |
Computed by PubChem (NCBI)