CAS 124244-65-1 appears in our catalog under these names: 2-Bromo-3,6-difluorobenzoic acid, 95%, 2-Bromo-3,6-difluorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-bromo-3,6-difluorobenzoic acid (CAS 124244-65-1) is a chemical compound with the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. IUPAC name: 2-bromo-3,6-difluorobenzoic acid. InChIKey: ZLBFRHCWALNQIJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF2O2 |
|---|---|
| Molecular weight | 237.00 g/mol |
| IUPAC name | 2-bromo-3,6-difluorobenzoic acid |
| InChIKey | ZLBFRHCWALNQIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)Br)F |
Computed by PubChem (NCBI)