cas: 175205-82-0 — see every product listed under this CAS number, including other names
2-Bromo-3-(trifluoromethyl)pyridine 98% (CAS 175205-82-0) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A220362-25g |
| cas | 175205-82-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 192.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A220362 |
2-bromo-3-(trifluoromethyl)pyridine (CAS 175205-82-0) is a chemical compound with the molecular formula C6H3BrF3N and a molecular weight of 225.99 g/mol. IUPAC name: 2-bromo-3-(trifluoromethyl)pyridine. InChIKey: OFGSIPQYQUVVPL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3N |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 2-bromo-3-(trifluoromethyl)pyridine |
| InChIKey | OFGSIPQYQUVVPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)