CAS 1481-21-6 appears in our catalog under these names: 2-Bromo-3,4,6-trifluoroaniline, 98%, 2-Bromo-3,4,6-trifluoroaniline 99%, 2-Bromo-3,4,6-trifluoroaniline, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g, 50g.
2-bromo-3,4,6-trifluoroaniline (CAS 1481-21-6) is a chemical compound with the molecular formula C6H3BrF3N and a molecular weight of 225.99 g/mol. IUPAC name: 2-bromo-3,4,6-trifluoroaniline. InChIKey: MRXOTDULAFLMDA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3N |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 2-bromo-3,4,6-trifluoroaniline |
| InChIKey | MRXOTDULAFLMDA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)N)F |
Computed by PubChem (NCBI)