cas: 59255-94-6 — see every product listed under this CAS number, including other names
2-Bromo-3-fluoronitrobenzene 95% (CAS 59255-94-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108260-500g |
| cas | 59255-94-6 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 6795.06 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1749.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108260 |
2-bromo-1-fluoro-3-nitrobenzene (CAS 59255-94-6) is a chemical compound with the molecular formula C6H3BrFNO2 and a molecular weight of 220.00 g/mol. IUPAC name: 2-bromo-1-fluoro-3-nitrobenzene. InChIKey: ICIVWQQTOYDXDM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrFNO2 |
|---|---|
| Molecular weight | 220.00 g/mol |
| IUPAC name | 2-bromo-1-fluoro-3-nitrobenzene |
| InChIKey | ICIVWQQTOYDXDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)