cas: 76066-07-4 — see every product listed under this CAS number, including other names
2-Bromo-3-methoxy-6-nitropyridine 95% (CAS 76066-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111604-250mg |
| cas | 76066-07-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 2005.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111604 |
2-bromo-3-methoxy-6-nitropyridine (CAS 76066-07-4) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 2-bromo-3-methoxy-6-nitropyridine. InChIKey: ZKEAOLVGPKCNCT-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 2-bromo-3-methoxy-6-nitropyridine |
| InChIKey | ZKEAOLVGPKCNCT-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)