Products 270912-79-3
CAS 270912-79-3 appears in our catalog under these names: 2-((5-Bromopyrimidin-2-yl)oxy)acetic acid, 98%, 2-((5-Bromopyrimidin-2-yl)oxy)acetic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(5-bromopyrimidin-2-yl)oxyacetic acid (CAS 270912-79-3) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 2-(5-bromopyrimidin-2-yl)oxyacetic acid. InChIKey: YNKPSWPVUXFTJB-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 2-(5-bromopyrimidin-2-yl)oxyacetic acid |
| InChIKey | YNKPSWPVUXFTJB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)OCC(=O)O)Br |
Computed by PubChem (NCBI)