cas: 132462-55-6 — see every product listed under this CAS number, including other names
2-Bromo-4,4'-dimethyl-1,1'-biphenyl, 91%, 91% (CAS 132462-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUCO-250mg |
| cas | 132462-55-6 |
| size | 250mg |
| availability | 9.92g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1994.00 Pln | |
| Chemat | 5g | 5368.40 Pln |
| purity | 91% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-methyl-1-(4-methylphenyl)benzene (CAS 132462-55-6) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 2-bromo-4-methyl-1-(4-methylphenyl)benzene. InChIKey: PBSPREZOOUXXRR-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 2-bromo-4-methyl-1-(4-methylphenyl)benzene |
| InChIKey | PBSPREZOOUXXRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)C)Br |
Computed by PubChem (NCBI)