CAS 132462-55-6 appears in our catalog under these names: 1,1'-Biphenyl, 2-bromo-4,4'-dimethyl-, 95%, 2–Bromo–4,4'–dimethyl–1,1'–biphenyl, 2-Bromo-4,4'-dimethyl-1,1'-biphenyl, 91%, 91%, 2-BROMO-4,4'-DIMETHYL-1,1'-BIPHENYL, 91%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-bromo-4-methyl-1-(4-methylphenyl)benzene (CAS 132462-55-6) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 2-bromo-4-methyl-1-(4-methylphenyl)benzene. InChIKey: PBSPREZOOUXXRR-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 2-bromo-4-methyl-1-(4-methylphenyl)benzene |
| InChIKey | PBSPREZOOUXXRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=C(C=C2)C)Br |
Computed by PubChem (NCBI)