cas: 35764-15-9 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethyl)benzonitrile 97% (CAS 35764-15-9) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179463-1000g |
| cas | 35764-15-9 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 5209.75 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 987.81 Pln | |
| Ambeed | 500g | 3279.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A179463 |
2-bromo-4-(trifluoromethyl)benzonitrile (CAS 35764-15-9) is a chemical compound with the molecular formula C8H3BrF3N and a molecular weight of 250.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)benzonitrile. InChIKey: YQDJZASWOJHHGY-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3N |
|---|---|
| Molecular weight | 250.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)benzonitrile |
| InChIKey | YQDJZASWOJHHGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)