CAS 2759141-82-5 is the registry number for 3-Bromo-5,6,7-trifluoro-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,6,7-trifluoro-1H-indole (CAS 2759141-82-5) is a chemical compound with the molecular formula C8H3BrF3N and a molecular weight of 250.01 g/mol. IUPAC name: 3-bromo-5,6,7-trifluoro-1H-indole. InChIKey: BCCMIDOOWJIPGA-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3N |
|---|---|
| Molecular weight | 250.01 g/mol |
| IUPAC name | 3-bromo-5,6,7-trifluoro-1H-indole |
| InChIKey | BCCMIDOOWJIPGA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CNC2=C(C(=C1F)F)F)Br |
Computed by PubChem (NCBI)